missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Potassium tetraoxalate dihydrate, Honeywell Fluka™
42.46€ - 161.76€
Identifiants chimiques
CAS | 6100-20-5 |
---|---|
Formule moléculaire | C4H3KO8 |
Poids moléculaire (g/mol) | 218.16 |
Numéro MDL | MFCD00150443,MFCD00150443 |
Clé InChI | GANDVAJEIJXBQJ-UHFFFAOYSA-M |
Synonyme | potassium trihydrogen dioxalate dihydrate, potassium ion oxalic acid dihydrate hydrogen oxalate, potassium oxalic acid dihydrate hydrogen oxalate |
CID PubChem | 131698588 |
Nom IUPAC | potassium oxalic acid hydrogen oxalate |
SMILES | [K+].OC(=O)C(O)=O.OC(=O)C([O-])=O |
Description
Identifiants chimiques
6100-20-5 | |
218.16 | |
GANDVAJEIJXBQJ-UHFFFAOYSA-M | |
131698588 | |
[K+].OC(=O)C(O)=O.OC(=O)C([O-])=O |
C4H3KO8 | |
MFCD00150443,MFCD00150443 | |
potassium trihydrogen dioxalate dihydrate, potassium ion oxalic acid dihydrate hydrogen oxalate, potassium oxalic acid dihydrate hydrogen oxalate | |
potassium oxalic acid hydrogen oxalate |
Spécification
Potassium tetraoxalate dihydrate | |
C4H3KO8 | |
MFCD00150443,MFCD00150443 | |
3854419 | |
GANDVAJEIJXBQJ-UHFFFAOYSA-M | |
potassium oxalic acid hydrogen oxalate | |
131698588 | |
≥99.5% |
6100-20-5 | |
KH3(C2O4)2 · 2H2O | |
NONH for all modes of transport | |
potassium trihydrogen dioxalate dihydrate, potassium ion oxalic acid dihydrate hydrogen oxalate, potassium oxalic acid dihydrate hydrogen oxalate | |
[K+].OC(=O)C(O)=O.OC(=O)C([O-])=O | |
218.16 | |
254.19g/mol |
Safety and Handling
P301 + P312 + P330-P305 + P351 + P338
Vous avez repéré une opportunité d'amélioration ?Partager une correction de contenu
Correction du contenu d'un produit
Veuillez fournir vos retours sur le contenu du produit en remplissant le formulaire ci-dessous.
Nom du produit